CAS 1261233-17-3

1,1-Dimethylethyl 3-[(4-chloro-5-methyl-2-pyrimidinyl)amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-[(4-chloro-5-methyl-2-pyrimidinyl)amino]-1-piperidinecarboxylate, identified by its CAS number 1261233-17-3, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyrimidine moiety. This substance typically exhibits properties associated with both amines and carboxylates, suggesting potential basicity and reactivity. The presence of the chloro and methyl groups on the pyrimidine ring may influence its biological activity and solubility. As a piperidine derivative, it may also exhibit pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular interactions could be significant in drug design, particularly in targeting specific biological pathways. Its stability, solubility, and reactivity would depend on the surrounding conditions, such as pH and solvent polarity. Overall, this compound represents a class of molecules that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.

Formula: C₁₅H₂₃ClN₄O₂

InChI: InChI=1S/C15H23ClN4O2/c1-10-8-17-13(19-12(10)16)18-11-6-5-7-20(9-11)14(21)22-15(2,3)4/h8,11H,5-7,9H2,1-4H3,(H,17,18,19)

InChI key: InChIKey=CESKSLXWUUQGDS-UHFFFAOYSA-N

SMILES: N(C1CN(C(OC(C)(C)C)=O)CCC1)C=2N=C(Cl)C(C)=CN2

Synonyms:

• 1-Piperidinecarboxylic acid, 3-[(4-chloro-5-methyl-2-pyrimidinyl)amino]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-[(4-chloro-5-methyl-2-pyrimidinyl)amino]-1-piperidinecarboxylate