CymitQuimica logo

CAS 1261233-42-4

:

4-Piperidinamine, N-methyl-1-(5-thiazolylmethyl)-, hydrochloride (1:1)

Description:
4-Piperidinamine, N-methyl-1-(5-thiazolylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and thiazole moieties, which contribute to its potential biological activity. The piperidine ring provides a basic nitrogen atom, making the compound a potential candidate for interactions with biological targets, such as receptors or enzymes. The thiazole group, known for its role in various pharmacological activities, enhances the compound's lipophilicity and may influence its ability to cross biological membranes. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in pharmaceutical formulations. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutics targeting neurological or infectious diseases. However, specific pharmacokinetic and pharmacodynamic properties would need to be evaluated through experimental studies to ascertain its efficacy and safety profile. Overall, this compound represents a class of substances that may hold promise in drug discovery and development.
Formula:C10H17N3S·ClH
InChI:InChI=1S/C10H17N3S.ClH/c1-11-9-2-4-13(5-3-9)7-10-6-12-8-14-10;/h6,8-9,11H,2-5,7H2,1H3;1H
InChI key:InChIKey=VBGANWVKGKYCMS-UHFFFAOYSA-N
SMILES:C(N1CCC(NC)CC1)C2=CN=CS2.Cl
Synonyms:
  • 4-Piperidinamine, N-methyl-1-(5-thiazolylmethyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.