CAS 1261233-55-9

1,1-Dimethylethyl N-[1-(2-chloro-4-pyrimidinyl)-4-piperidinyl]-N-methylcarbamate

Description:

1,1-Dimethylethyl N-[1-(2-chloro-4-pyrimidinyl)-4-piperidinyl]-N-methylcarbamate, identified by its CAS number 1261233-55-9, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure that includes a dimethyl group, a pyrimidine ring, and a piperidine moiety, contributing to its potential biological activity. It is characterized by its ability to interact with specific biological targets, which may include enzymes or receptors, making it of interest in pharmaceutical research. The presence of the chloro substituent on the pyrimidine ring can influence its reactivity and solubility properties. Additionally, the compound may exhibit specific physicochemical characteristics such as melting point, boiling point, and solubility in various solvents, which are essential for its application in drug formulation and development. Safety and handling precautions are necessary, as with many chemical substances, due to potential toxicity or environmental impact. Overall, this compound represents a significant area of study in medicinal chemistry and agrochemical applications.

Formula: C₁₅H₂₃ClN₄O₂

InChI: InChI=1S/C15H23ClN4O2/c1-15(2,3)22-14(21)19(4)11-6-9-20(10-7-11)12-5-8-17-13(16)18-12/h5,8,11H,6-7,9-10H2,1-4H3

InChI key: InChIKey=UPCNWSCIJVRLSN-UHFFFAOYSA-N

SMILES: ClC=1N=C(C=CN1)N2CCC(N(C(OC(C)(C)C)=O)C)CC2

Synonyms:

• tert-Butyl N-[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamate
• [1-(2-Chloro-pyrimidin-4-yl)-piperidin-4-yl]-methyl-carbamic acid tert-butyl ester
• 1,1-Dimethylethyl N-[1-(2-chloro-4-pyrimidinyl)-4-piperidinyl]-N-methylcarbamate
• Carbamic acid, N-[1-(2-chloro-4-pyrimidinyl)-4-piperidinyl]-N-methyl-, 1,1-dimethylethyl ester