CAS 1261233-60-6

trans-4-[(4-Chloro-2-pyrimidinyl)amino]cyclohexanol

Description:

Trans-4-[(4-Chloro-2-pyrimidinyl)amino]cyclohexanol is a chemical compound characterized by its unique structural features, which include a cyclohexanol ring and a pyrimidine moiety. The presence of the 4-chloro substituent on the pyrimidine ring contributes to its biological activity, potentially influencing its interaction with various biological targets. The trans configuration of the cyclohexanol portion suggests specific stereochemical properties that may affect its solubility and reactivity. This compound may exhibit properties typical of both alcohols and amines, such as hydrogen bonding capabilities, which can impact its pharmacokinetics and pharmacodynamics. Additionally, the presence of the pyrimidine ring may suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific pathways or receptors. Overall, the characteristics of trans-4-[(4-Chloro-2-pyrimidinyl)amino]cyclohexanol make it a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₀H₁₄ClN₃O

InChI: InChI=1/C10H14ClN3O/c11-9-5-6-12-10(14-9)13-7-1-3-8(15)4-2-7/h5-8,15H,1-4H2,(H,12,13,14)/t7-,8-

InChI key: InChIKey=ILTLLTHPBPWSEB-ZKCHVHJHNA-N

SMILES: N(C=1N=C(Cl)C=CN1)[C@@H]2CC[C@@H](O)CC2

Synonyms:

• trans-4-[(4-Chloro-2-pyrimidinyl)amino]cyclohexanol
• Cyclohexanol, 4-[(4-chloro-2-pyrimidinyl)amino]-, trans-

trans-4-((4-Chloropyrimidin-2-yl)amino)cyclohexanol

CAS: 1261233-60-6

Formula: C₁₀H₁₄ClN₃O

Molecular weight: 227.6907

Ref: IN-DA000ROH