CymitQuimica logo

CAS 1261233-63-9

:

1,1-Dimethylethyl 4-(6-chloro-3-pyridazinyl)-2-methyl-1-piperazinecarboxylate

Description:
1,1-Dimethylethyl 4-(6-chloro-3-pyridazinyl)-2-methyl-1-piperazinecarboxylate, identified by its CAS number 1261233-63-9, is a chemical compound that features a complex structure incorporating a piperazine ring, a pyridazine moiety, and an ester functional group. This compound is characterized by its potential biological activity, often explored in pharmaceutical research for its possible applications in drug development. The presence of the chloro substituent on the pyridazine ring may influence its reactivity and interaction with biological targets. Additionally, the dimethyl and methyl groups contribute to its steric properties, which can affect its solubility and permeability. The compound's synthesis typically involves multi-step organic reactions, and its stability can be influenced by environmental factors such as temperature and pH. As with many synthetic organic compounds, understanding its physicochemical properties, such as melting point, boiling point, and solubility, is crucial for its application in various fields, including medicinal chemistry and agrochemicals.
Formula:C14H21ClN4O2
InChI:InChI=1S/C14H21ClN4O2/c1-10-9-18(12-6-5-11(15)16-17-12)7-8-19(10)13(20)21-14(2,3)4/h5-6,10H,7-9H2,1-4H3
InChI key:InChIKey=YFAITYMWAJRUNA-UHFFFAOYSA-N
SMILES:CC1CN(CCN1C(OC(C)(C)C)=O)C2=CC=C(Cl)N=N2
Synonyms:
  • 1,1-Dimethylethyl 4-(6-chloro-3-pyridazinyl)-2-methyl-1-piperazinecarboxylate
  • 1-Piperazinecarboxylic acid, 4-(6-chloro-3-pyridazinyl)-2-methyl-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.