CAS 1261233-69-5

Pyridine, 2-bromo-6-[(3R)-3-pyrrolidinyloxy]-, hydrochloride (1:1)

Description:

Pyridine, 2-bromo-6-[(3R)-3-pyrrolidinyloxy]-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine substituent at the 2-position and a pyrrolidine-derived oxy group at the 6-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit specific pharmacological properties due to the presence of the pyrrolidine moiety, which is often associated with neuroactive compounds. Its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and applications in research and industry.

Formula: C₉H₁₁BrN₂O·ClH

InChI: InChI=1S/C9H11BrN2O.ClH/c10-8-2-1-3-9(12-8)13-7-4-5-11-6-7;/h1-3,7,11H,4-6H2;1H/t7-;/m1./s1

InChI key: InChIKey=KPPWZMILWSKPGR-OGFXRTJISA-N

SMILES: O(C=1N=C(Br)C=CC1)[C@@H]2CCNC2.Cl

Synonyms:

• Pyridine, 2-bromo-6-[(3R)-3-pyrrolidinyloxy]-, hydrochloride (1:1)