CAS 1261233-76-4

Piperazine, 1-[(4-fluorophenyl)methyl]-3-methyl-, hydrochloride (1:1)

Description:

Piperazine, 1-[(4-fluorophenyl)methyl]-3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a 4-fluorobenzyl group and a methyl substituent at the 3-position contributes to its unique properties. This compound typically appears as a white to off-white crystalline solid and is soluble in water, which is common for hydrochloride salts. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of psychoactive or therapeutic agents. The hydrochloride form indicates that it is a salt, which often enhances stability and solubility compared to its free base form. Safety data should be consulted for handling and exposure, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound exemplifies the diverse chemistry of piperazine derivatives and their applications in medicinal chemistry.

Formula: C₁₂H₁₇FN₂·ClH

InChI: InChI=1S/C12H17FN2.ClH/c1-10-8-15(7-6-14-10)9-11-2-4-12(13)5-3-11;/h2-5,10,14H,6-9H2,1H3;1H

InChI key: InChIKey=ACDJKLIPMUVKCP-UHFFFAOYSA-N

SMILES: C(N1CC(C)NCC1)C2=CC=C(F)C=C2.Cl

Synonyms:

• Piperazine, 1-[(4-fluorophenyl)methyl]-3-methyl-, hydrochloride (1:1)