CAS 1261233-84-4

3-Piperidinemethanamine, N-[(3-chlorophenyl)methyl]-, hydrochloride (1:1)

Description:

3-Piperidinemethanamine, N-[(3-chlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential for forming salts, such as the hydrochloride form. This compound features a chlorophenyl group, which can influence its biological activity and lipophilicity. The presence of the amine functional group suggests that it may engage in hydrogen bonding, affecting its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its specific properties, such as melting point, solubility, and biological activity, would depend on the precise molecular interactions and the environment in which it is studied. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential pharmacological effects.

Formula: C₁₃H₁₉ClN₂·ClH

InChI: InChI=1S/C13H19ClN2.ClH/c14-13-5-1-3-11(7-13)8-16-10-12-4-2-6-15-9-12;/h1,3,5,7,12,15-16H,2,4,6,8-10H2;1H

InChI key: InChIKey=BSFITFPBPWDEHC-UHFFFAOYSA-N

SMILES: C(NCC1CCCNC1)C2=CC(Cl)=CC=C2.Cl

Synonyms:

• 3-Piperidinemethanamine, N-[(3-chlorophenyl)methyl]-, hydrochloride (1:1)