CAS 1261233-86-6
:1-(5-Fluoro-2-pyrimidinyl)-3-pyrrolidinol
Description:
1-(5-Fluoro-2-pyrimidinyl)-3-pyrrolidinol is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a fluorine atom and a pyrrolidine moiety. The presence of the fluorine atom enhances the compound's lipophilicity and can influence its biological activity. This compound is typically classified as a heterocyclic organic compound due to the presence of nitrogen atoms in both the pyrimidine and pyrrolidine rings. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The hydroxyl group in the pyrrolidinol part of the molecule may contribute to its solubility and reactivity, making it a candidate for further chemical modifications. Additionally, the compound's specific interactions with biological targets can be explored through structure-activity relationship studies, which are essential in drug design and development. Overall, 1-(5-Fluoro-2-pyrimidinyl)-3-pyrrolidinol represents a class of compounds that may exhibit interesting pharmacological properties.
Formula:C8H10FN3O
InChI:InChI=1S/C8H10FN3O/c9-6-3-10-8(11-4-6)12-2-1-7(13)5-12/h3-4,7,13H,1-2,5H2
InChI key:InChIKey=VEXNQGJAKXVXCY-UHFFFAOYSA-N
SMILES:OC1CN(C=2N=CC(F)=CN2)CC1
Synonyms:- 1-(5-Fluoro-2-pyrimidinyl)-3-pyrrolidinol
- 3-Pyrrolidinol, 1-(5-fluoro-2-pyrimidinyl)-
- 1-(5-Fluoro-pyrimidin-2-yl)-pyrrolidin-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
