CAS 1261233-90-2

Pyrrolidine, 2-[[(3-fluorophenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 2-[[(3-fluorophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 3-fluorophenyl group and a methoxy methyl substituent contributes to its unique properties, potentially influencing its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The fluorine atom in the phenyl ring may enhance lipophilicity and metabolic stability, making it a candidate for drug development. This compound may exhibit various pharmacological effects, but specific biological activities would depend on its interaction with biological targets. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential pharmacological implications. Further studies would be necessary to fully elucidate its properties and potential applications in medicinal chemistry.

Formula: C₁₂H₁₆FNO·ClH

InChI: InChI=1S/C12H16FNO.ClH/c13-11-4-1-3-10(7-11)8-15-9-12-5-2-6-14-12;/h1,3-4,7,12,14H,2,5-6,8-9H2;1H

InChI key: InChIKey=IUGXQJGMYRRILL-UHFFFAOYSA-N

SMILES: C(OCC1CCCN1)C2=CC(F)=CC=C2.Cl

Synonyms:

• Pyrrolidine, 2-[[(3-fluorophenyl)methoxy]methyl]-, hydrochloride (1:1)