CAS 1261234-01-8
:1-(4-Chloro-6-methyl-2-pyrimidinyl)-4-piperidinemethanol
Description:
1-(4-Chloro-6-methyl-2-pyrimidinyl)-4-piperidinemethanol is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a chlorine atom and a methyl group, as well as a piperidine moiety linked to a hydroxymethyl group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the hydroxymethyl group, while its aromatic and heterocyclic components may contribute to its biological activity. The chlorine substituent can influence the compound's reactivity and interaction with biological targets, potentially enhancing its pharmacological properties. Additionally, the piperidine ring may impart basic characteristics, allowing for interactions with various receptors or enzymes. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C11H16ClN3O
InChI:InChI=1S/C11H16ClN3O/c1-8-6-10(12)14-11(13-8)15-4-2-9(7-16)3-5-15/h6,9,16H,2-5,7H2,1H3
InChI key:InChIKey=LCJFWEKRXSGDAB-UHFFFAOYSA-N
SMILES:CC1=NC(=NC(Cl)=C1)N2CCC(CO)CC2
Synonyms:- 1-(4-Chloro-6-methyl-2-pyrimidinyl)-4-piperidinemethanol
- 4-Piperidinemethanol, 1-(4-chloro-6-methyl-2-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.