CymitQuimica logo

CAS 1261234-03-0

:

Pyrazine, 2-methyl-3-(2-pyrrolidinylmethoxy)-, hydrochloride (1:1)

Description:
Pyrazine, 2-methyl-3-(2-pyrrolidinylmethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyrazine ring substituted with a methyl group and a pyrrolidinylmethoxy group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications. The presence of the pyrrolidinyl group suggests potential interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. The compound may exhibit properties such as moderate to high polarity due to the functional groups present, influencing its reactivity and interaction with other substances. Additionally, the hydrochloride form often indicates stability and ease of handling in laboratory settings. As with many organic compounds, safety data should be consulted to understand its toxicity, handling precautions, and environmental impact. Overall, this compound's specific characteristics and potential applications would require further investigation through experimental studies and literature reviews.
Formula:C10H15N3O·ClH
InChI:InChI=1S/C10H15N3O.ClH/c1-8-10(13-6-5-11-8)14-7-9-3-2-4-12-9;/h5-6,9,12H,2-4,7H2,1H3;1H
InChI key:InChIKey=IULBYRSNGDSAQT-UHFFFAOYSA-N
SMILES:O(CC1CCCN1)C=2C(C)=NC=CN2.Cl
Synonyms:
  • Pyrazine, 2-methyl-3-(2-pyrrolidinylmethoxy)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.