CAS 1261234-25-6
:(3R)-1-[2-(Methylthio)-4-pyrimidinyl]-3-pyrrolidinol
Description:
(3R)-1-[2-(Methylthio)-4-pyrimidinyl]-3-pyrrolidinol is a chemical compound characterized by its specific stereochemistry and functional groups. The presence of a pyrimidine ring, which is a six-membered aromatic heterocycle containing nitrogen atoms, contributes to its potential biological activity. The methylthio group attached to the pyrimidine enhances its lipophilicity and may influence its interaction with biological targets. The pyrrolidinol moiety indicates the presence of a five-membered ring containing nitrogen and a hydroxyl group, which can participate in hydrogen bonding and may affect the compound's solubility and reactivity. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its stereochemistry, denoted by the (3R) configuration, suggests that it may have specific interactions with biological receptors or enzymes, which can be crucial for its efficacy and safety profile. Overall, the combination of these structural features suggests that (3R)-1-[2-(Methylthio)-4-pyrimidinyl]-3-pyrrolidinol could be a valuable compound in drug development and research.
Formula:C9H13N3OS
InChI:InChI=1S/C9H13N3OS/c1-14-9-10-4-2-8(11-9)12-5-3-7(13)6-12/h2,4,7,13H,3,5-6H2,1H3/t7-/m1/s1
InChI key:InChIKey=CFEKLRCUPFZBTM-SSDOTTSWSA-N
SMILES:S(C)C=1N=C(C=CN1)N2C[C@H](O)CC2
Synonyms:- 3-Pyrrolidinol, 1-[2-(methylthio)-4-pyrimidinyl]-, (3R)-
- (3R)-1-[2-(Methylthio)-4-pyrimidinyl]-3-pyrrolidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.