CAS 1261234-34-7

3-Piperidinamine, 1-[6-chloro-2-(methylthio)-4-pyrimidinyl]-N-methyl-, hydrochloride (1:1)

Description:

3-Piperidinamine, 1-[6-chloro-2-(methylthio)-4-pyrimidinyl]-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and pyrimidine moieties, which contribute to its biological activity. The presence of a chlorine atom and a methylthio group on the pyrimidine ring enhances its pharmacological properties, potentially influencing its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including medicinal chemistry. The compound may exhibit properties such as being a potential inhibitor or modulator of specific biological pathways, making it of interest in drug development. Its molecular structure suggests it could interact with neurotransmitter systems or other cellular mechanisms, although specific biological activities would require empirical investigation. Safety and handling considerations are essential, as with any chemical substance, particularly in research and pharmaceutical contexts. Proper characterization through techniques such as NMR, mass spectrometry, and chromatography is crucial for confirming its identity and purity in laboratory settings.

Formula: C₁₁H₁₇ClN₄S·ClH

InChI: InChI=1S/C11H17ClN4S.ClH/c1-13-8-4-3-5-16(7-8)10-6-9(12)14-11(15-10)17-2;/h6,8,13H,3-5,7H2,1-2H3;1H

InChI key: InChIKey=NBEDNWMXPFSYSV-UHFFFAOYSA-N

SMILES: S(C)C=1N=C(C=C(Cl)N1)N2CC(NC)CCC2.Cl

Synonyms:

• 3-Piperidinamine, 1-[6-chloro-2-(methylthio)-4-pyrimidinyl]-N-methyl-, hydrochloride (1:1)