CymitQuimica logo

CAS 1261234-71-2

:

1-[2-(Methylthio)-4-pyrimidinyl]-3-piperidinol

Description:
1-[2-(Methylthio)-4-pyrimidinyl]-3-piperidinol, identified by its CAS number 1261234-71-2, is a chemical compound characterized by its unique structural features, which include a pyrimidine ring substituted with a methylthio group and a piperidinol moiety. This compound typically exhibits properties associated with both heterocyclic and aliphatic structures, contributing to its potential biological activity. The presence of the methylthio group may enhance lipophilicity, influencing its solubility and permeability in biological systems. Additionally, the piperidinol structure can participate in hydrogen bonding, which may affect its interaction with biological targets. The compound's molecular configuration suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as chromatography. Overall, 1-[2-(Methylthio)-4-pyrimidinyl]-3-piperidinol represents a compound of interest for further research in drug discovery and development.
Formula:C10H15N3OS
InChI:InChI=1S/C10H15N3OS/c1-15-10-11-5-4-9(12-10)13-6-2-3-8(14)7-13/h4-5,8,14H,2-3,6-7H2,1H3
InChI key:InChIKey=QGRBHTGCPAWUDJ-UHFFFAOYSA-N
SMILES:S(C)C=1N=C(C=CN1)N2CC(O)CCC2
Synonyms:
  • 1-[2-(Methylthio)-4-pyrimidinyl]-3-piperidinol
  • 3-Piperidinol, 1-[2-(methylthio)-4-pyrimidinyl]-
  • 1-(2-Methylsulfanyl-pyrimidin-4-yl)-piperidin-3-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.