CymitQuimica logo

CAS 1261234-85-8

:

Piperazine, 1-[(5-bromo-2-thienyl)sulfonyl]-2-methyl-, hydrochloride (1:1)

Description:
Piperazine, 1-[(5-bromo-2-thienyl)sulfonyl]-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a sulfonyl group attached to a 5-bromo-2-thienyl moiety contributes to its unique properties, including potential biological activity. The hydrochloride form indicates that the compound is a salt, enhancing its solubility in water, which is often beneficial for pharmacological applications. This compound may exhibit various characteristics such as moderate to high polarity due to the sulfonyl and halogen substituents, influencing its interaction with biological targets. Additionally, the bromine atom can impart specific reactivity and stability features. The compound's structure suggests potential uses in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders or other therapeutic areas. However, detailed studies on its pharmacokinetics, toxicity, and efficacy would be necessary to fully understand its potential applications.
Formula:C9H13BrN2O2S2·ClH
InChI:InChI=1S/C9H13BrN2O2S2.ClH/c1-7-6-11-4-5-12(7)16(13,14)9-3-2-8(10)15-9;/h2-3,7,11H,4-6H2,1H3;1H
InChI key:InChIKey=HRYZRYIAYOJDLW-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C(C)CNCC1)C=2SC(Br)=CC2.Cl
Synonyms:
  • Piperazine, 1-[(5-bromo-2-thienyl)sulfonyl]-2-methyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.