
CAS 1261234-94-9
:3-Piperidinamine, 1-(6-chloro-3-pyridazinyl)-N-methyl-, hydrochloride (1:1)
Description:
3-Piperidinamine, 1-(6-chloro-3-pyridazinyl)-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and pyridazine moieties. The presence of the piperidine ring contributes to its basicity and potential for forming salts, while the chlorinated pyridazine component may impart specific biological activity or pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound's structure suggests it may interact with biological targets, potentially influencing neurotransmitter systems or other pathways. Its CAS number, 1261234-94-9, allows for precise identification in chemical databases. Safety and handling considerations are essential, as with many amines and halogenated compounds, due to potential toxicity and reactivity. Overall, this compound's unique structural features may make it of interest in medicinal chemistry and drug development, although specific biological activities would require further investigation through empirical studies.
Formula:C10H15ClN4·ClH
InChI:InChI=1S/C10H15ClN4.ClH/c1-12-8-3-2-6-15(7-8)10-5-4-9(11)13-14-10;/h4-5,8,12H,2-3,6-7H2,1H3;1H
InChI key:InChIKey=QPPBQGYECDUAJH-UHFFFAOYSA-N
SMILES:N(C)C1CN(CCC1)C2=CC=C(Cl)N=N2.Cl
Synonyms:- 3-Piperidinamine, 1-(6-chloro-3-pyridazinyl)-N-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.