
CAS 1261234-96-1
:Pyridine, 4-(2-pyrrolidinylmethoxy)-, hydrochloride (1:1)
Description:
Pyridine, 4-(2-pyrrolidinylmethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a pyrrolidinyl group indicates a five-membered saturated nitrogen-containing ring, which contributes to the compound's biological activity and solubility properties. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it useful in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit properties such as being a potential ligand in coordination chemistry or acting as a building block in drug development. Its specific interactions and reactivity can be influenced by the functional groups attached to the pyridine and pyrrolidine moieties. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C10H14N2O.ClH
InChI:InChI=1S/C10H14N2O.ClH/c1-2-9(12-5-1)8-13-10-3-6-11-7-4-10;/h3-4,6-7,9,12H,1-2,5,8H2;1H
InChI key:InChIKey=MZTJCFJXDBCZPG-UHFFFAOYSA-N
SMILES:O(CC1CCCN1)C=2C=CN=CC2.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.