CAS 1261235-06-6
:1,1-Dimethylethyl 4-[(3-methyl-2-pyrazinyl)oxy]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 4-[(3-methyl-2-pyrazinyl)oxy]-1-piperidinecarboxylate, identified by its CAS number 1261235-06-6, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound includes a dimethyl group and a pyrazine moiety, indicating potential biological activity due to the presence of these functional groups. The structure suggests that it may exhibit lipophilic characteristics, which could influence its solubility and permeability in biological systems. The presence of the ether linkage (the pyrazinyl group connected via an oxygen atom) may also contribute to its reactivity and interaction with other molecules. Such compounds are often studied for their pharmacological properties, and their specific interactions with biological targets can be explored through various assays. Overall, the unique combination of functional groups in this compound may lead to interesting applications in medicinal chemistry and drug development.
Formula:C15H23N3O3
InChI:InChI=1S/C15H23N3O3/c1-11-13(17-8-7-16-11)20-12-5-9-18(10-6-12)14(19)21-15(2,3)4/h7-8,12H,5-6,9-10H2,1-4H3
InChI key:InChIKey=MAZXEQLEKZBXSC-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCC(OC=2C(C)=NC=CN2)CC1
Synonyms:- 1,1-Dimethylethyl 4-[(3-methyl-2-pyrazinyl)oxy]-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 4-[(3-methyl-2-pyrazinyl)oxy]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.