CAS 1261235-12-4
:1,1-Dimethylethyl 2-methyl-4-(4-methyl-2-pyrimidinyl)-1-piperazinecarboxylate
Description:
1,1-Dimethylethyl 2-methyl-4-(4-methyl-2-pyrimidinyl)-1-piperazinecarboxylate, identified by its CAS number 1261235-12-4, is a chemical compound that belongs to the class of piperazine derivatives. This substance typically exhibits characteristics such as a complex molecular structure, which includes a piperazine ring, a pyrimidine moiety, and various alkyl groups. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural features that may interact with biological targets. The presence of multiple functional groups suggests that it may exhibit diverse chemical reactivity and solubility properties, which can be influenced by the steric and electronic effects of the substituents. Additionally, compounds of this nature may possess specific biological activities, making them of interest for further research in drug discovery and development. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C15H24N4O2
InChI:InChI=1S/C15H24N4O2/c1-11-6-7-16-13(17-11)18-8-9-19(12(2)10-18)14(20)21-15(3,4)5/h6-7,12H,8-10H2,1-5H3
InChI key:InChIKey=SRKSXHOMPGFFFO-UHFFFAOYSA-N
SMILES:CC1CN(CCN1C(OC(C)(C)C)=O)C=2N=C(C)C=CN2
Synonyms:- 1,1-Dimethylethyl 2-methyl-4-(4-methyl-2-pyrimidinyl)-1-piperazinecarboxylate
- 1-Piperazinecarboxylic acid, 2-methyl-4-(4-methyl-2-pyrimidinyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.