CAS 1261235-14-6

3-Piperidinamine, N-[(4-fluorophenyl)methyl]-, hydrochloride (1:1)

Description:

3-Piperidinamine, N-[(4-fluorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, enhancing the compound's lipophilicity and potentially influencing its biological activity. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for pharmaceutical applications. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of therapeutic agents, due to its amine functional group that can participate in hydrogen bonding and interact with biological targets. Its specific applications and effects would depend on further studies, including pharmacological evaluations and structure-activity relationship analyses. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₂H₁₇FN₂·ClH

InChI: InChI=1S/C12H17FN2.ClH/c13-11-5-3-10(4-6-11)8-15-12-2-1-7-14-9-12;/h3-6,12,14-15H,1-2,7-9H2;1H

InChI key: InChIKey=AAMMNECPOBTPHR-UHFFFAOYSA-N

SMILES: C(NC1CCCNC1)C2=CC=C(F)C=C2.Cl

Synonyms:

• 3-Piperidinamine, N-[(4-fluorophenyl)methyl]-, hydrochloride (1:1)

N-(4-Fluorobenzyl)piperidin-3-amine hydrochloride

CAS: 1261235-14-6

N-(4-Fluorobenzyl)piperidin-3-amine hydrochloride

Purity: 98%

Molecular weight: 244.74g/mol

Ref: 54-PC111242

(4-Fluoro-benzyl)-piperidin-3-yl-amine hydrochloride

CAS: 1261235-14-6

Formula: C₁₂H₁₈ClFN₂

Purity: 98%

Molecular weight: 244.74

Ref: 10-F089777