
CAS 1261235-32-8
:2-Thiophenesulfonamide, N-methyl-N-4-piperidinyl-, hydrochloride (1:1)
Description:
2-Thiophenesulfonamide, N-methyl-N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a thiophene ring contributes to its aromatic characteristics and potential biological activity. The N-methyl-N-4-piperidinyl moiety suggests that the compound may exhibit basic properties due to the piperidine nitrogen, which can participate in hydrogen bonding and influence solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. This compound may be of interest in medicinal chemistry, particularly in the development of therapeutics targeting various biological pathways. Its specific interactions, pharmacokinetics, and potential therapeutic uses would require further investigation through experimental studies. Overall, the structural features of this compound indicate a potential for diverse applications in drug development and research.
Formula:C10H16N2O2S2·ClH
InChI:InChI=1S/C10H16N2O2S2.ClH/c1-12(9-4-6-11-7-5-9)16(13,14)10-3-2-8-15-10;/h2-3,8-9,11H,4-7H2,1H3;1H
InChI key:InChIKey=OLEXDMQCVVWWIC-UHFFFAOYSA-N
SMILES:N(S(=O)(=O)C1=CC=CS1)(C)C2CCNCC2.Cl
Synonyms:- 2-Thiophenesulfonamide, N-methyl-N-4-piperidinyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.