CAS 1261235-54-4
:1,1-Dimethylethyl N-[[1-[(5-bromo-2-thienyl)sulfonyl]-2-piperidinyl]methyl]carbamate
Description:
1,1-Dimethylethyl N-[[1-[(5-bromo-2-thienyl)sulfonyl]-2-piperidinyl]methyl]carbamate, identified by its CAS number 1261235-54-4, is a synthetic organic compound characterized by its complex structure, which includes a carbamate functional group and a thienyl moiety. The presence of the 5-bromo-2-thienyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the unique electronic and steric properties imparted by the bromine atom and the thiophene ring. The piperidine ring contributes to the compound's basicity and potential interactions with biological targets. This compound is likely to exhibit moderate to high lipophilicity, influencing its solubility and permeability in biological systems. Additionally, the presence of the sulfonyl group may enhance its reactivity and stability, making it a candidate for further chemical modifications. Overall, this compound's unique structural features may provide valuable insights into its biological activity and potential therapeutic applications.
Formula:C15H23BrN2O4S2
InChI:InChI=1S/C15H23BrN2O4S2/c1-15(2,3)22-14(19)17-10-11-6-4-5-9-18(11)24(20,21)13-8-7-12(16)23-13/h7-8,11H,4-6,9-10H2,1-3H3,(H,17,19)
InChI key:InChIKey=MBDPODRKVKVACV-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C(CNC(OC(C)(C)C)=O)CCCC1)C2=CC=C(Br)S2
Synonyms:- Carbamic acid, N-[[1-[(5-bromo-2-thienyl)sulfonyl]-2-piperidinyl]methyl]-, 1,1-dimethylethyl ester
- tert-Butyl N-[[1-(5-bromothiophen-2-yl)sulfonylpiperidin-2-yl]methyl]carbamate
- 1,1-Dimethylethyl N-[[1-[(5-bromo-2-thienyl)sulfonyl]-2-piperidinyl]methyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.