
CAS 1261235-60-2
:4-Piperidinamine, N-[(2,6-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1)
Description:
4-Piperidinamine, N-[(2,6-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The compound features a dichlorophenyl group, indicating the presence of two chlorine atoms on a phenyl ring at the 2 and 6 positions, contributing to its lipophilicity and potential biological activity. The N-methyl substitution enhances its basicity and solubility in polar solvents. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for pharmaceutical applications. This compound may exhibit various pharmacological properties, potentially acting as a ligand for certain receptors or enzymes, and is of interest in medicinal chemistry for its potential therapeutic uses. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.
Formula:C13H19Cl3N2
InChI:InChI=1S/C13H18Cl2N2.ClH/c1-17(10-5-7-16-8-6-10)9-11-12(14)3-2-4-13(11)15;/h2-4,10,16H,5-9H2,1H3;1H
InChI key:InChIKey=JGKLWNZMDHZYNZ-UHFFFAOYSA-N
SMILES:C(N(C)C1CCNCC1)C2=C(Cl)C=CC=C2Cl.Cl
Synonyms:- 4-Piperidinamine, N-[(2,6-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1)
- N-(2,6-DICHLOROBENZYL)-N-METHYLPIPERIDIN-4-AMINE HYDROCHLORIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.