CAS 1261235-64-6
:trans-4-[(4-Chloro-5-methyl-2-pyrimidinyl)amino]cyclohexanol
Description:
Trans-4-[(4-Chloro-5-methyl-2-pyrimidinyl)amino]cyclohexanol is a chemical compound characterized by its unique structural features, including a cyclohexanol ring and a pyrimidine moiety. The presence of a chloro group and a methyl group on the pyrimidine ring contributes to its chemical reactivity and potential biological activity. This compound is typically classified as an organic amine due to the amino group attached to the pyrimidine. Its trans configuration indicates specific stereochemistry, which can influence its interactions with biological targets. The compound may exhibit properties such as solubility in polar solvents, and its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific pathways. Additionally, the presence of the cyclohexanol structure may impart certain conformational flexibility, which can be crucial for binding interactions. Overall, the characteristics of this compound make it a subject of interest in medicinal chemistry and drug design.
Formula:C11H16ClN3O
InChI:InChI=1/C11H16ClN3O/c1-7-6-13-11(15-10(7)12)14-8-2-4-9(16)5-3-8/h6,8-9,16H,2-5H2,1H3,(H,13,14,15)/t8-,9-
InChI key:InChIKey=VLACQWICPSBIKC-KYZUINATNA-N
SMILES:N(C=1N=C(Cl)C(C)=CN1)[C@@H]2CC[C@@H](O)CC2
Synonyms:- trans-4-[(4-Chloro-5-methyl-2-pyrimidinyl)amino]cyclohexanol
- Cyclohexanol, 4-[(4-chloro-5-methyl-2-pyrimidinyl)amino]-, trans-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.