CymitQuimica logo

CAS 1261235-67-9

:

4-Piperidinamine, N-[(2,5-dichlorophenyl)methyl]-, hydrochloride (1:1)

Description:
4-Piperidinamine, N-[(2,5-dichlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of the 2,5-dichlorophenyl group indicates that the compound has two chlorine substituents on a phenyl ring, contributing to its potential biological activity and lipophilicity. As a hydrochloride salt, it is typically more soluble in water than its free base form, which can enhance its bioavailability in pharmaceutical applications. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of therapeutic agents. Its structure suggests potential interactions with biological targets, making it of interest in drug discovery. However, specific pharmacological effects, toxicity, and safety profiles would require further investigation through experimental studies. Overall, the unique combination of functional groups and structural features makes this compound a candidate for various applications in medicinal chemistry and related fields.
Formula:C12H16Cl2N2·ClH
InChI:InChI=1S/C12H16Cl2N2.ClH/c13-10-1-2-12(14)9(7-10)8-16-11-3-5-15-6-4-11;/h1-2,7,11,15-16H,3-6,8H2;1H
InChI key:InChIKey=KCVUHOHFZZPSPB-UHFFFAOYSA-N
SMILES:C(NC1CCNCC1)C2=C(Cl)C=CC(Cl)=C2.Cl
Synonyms:
  • 4-Piperidinamine, N-[(2,5-dichlorophenyl)methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.