CAS 1261235-70-4

1-[(3,4-Dichlorophenyl)methyl]-2-piperidinemethanol

Description:

1-[(3,4-Dichlorophenyl)methyl]-2-piperidinemethanol, identified by its CAS number 1261235-70-4, is a chemical compound characterized by its piperidine structure, which includes a piperidine ring substituted with a 3,4-dichlorobenzyl group and a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the dichlorophenyl moiety suggests that it may interact with various biological targets, potentially influencing its pharmacological profile. The hydroxymethyl group can enhance solubility and reactivity, making it a candidate for further chemical modifications. In terms of physical properties, it is likely to be a solid or liquid at room temperature, depending on its specific formulation and purity. The compound's unique structure may confer specific interactions in biological systems, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₃H₁₇Cl₂NO

InChI: InChI=1S/C13H17Cl2NO/c14-12-5-4-10(7-13(12)15)8-16-6-2-1-3-11(16)9-17/h4-5,7,11,17H,1-3,6,8-9H2

InChI key: InChIKey=BQAILLXPFQMCTH-UHFFFAOYSA-N

SMILES: C(N1C(CO)CCCC1)C2=CC(Cl)=C(Cl)C=C2

Synonyms:

• 2-Piperidinemethanol, 1-[(3,4-dichlorophenyl)methyl]-
• 1-[(3,4-Dichlorophenyl)methyl]-2-piperidinemethanol
• CW1143