CAS 1261235-82-8

3-Piperidinemethanamine, 1-[(2-fluorophenyl)methyl]-, hydrochloride (1:1)

Description:

3-Piperidinemethanamine, 1-[(2-fluorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential as a pharmacological agent. The presence of a 2-fluorophenyl group enhances its lipophilicity, potentially influencing its ability to cross biological membranes. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for formulation in pharmaceutical applications. This compound may exhibit biological activity, possibly interacting with neurotransmitter systems, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in the development of therapeutic agents, particularly in the treatment of neurological or psychiatric disorders. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacokinetic properties, mechanism of action, and therapeutic efficacy.

Formula: C₁₃H₁₉FN₂·ClH

InChI: InChI=1S/C13H19FN2.ClH/c14-13-6-2-1-5-12(13)10-16-7-3-4-11(8-15)9-16;/h1-2,5-6,11H,3-4,7-10,15H2;1H

InChI key: InChIKey=HPSSZODPXQGYSB-UHFFFAOYSA-N

SMILES: C(N1CC(CN)CCC1)C2=C(F)C=CC=C2.Cl

Synonyms:

• 3-Piperidinemethanamine, 1-[(2-fluorophenyl)methyl]-, hydrochloride (1:1)