CymitQuimica logo

CAS 1261236-32-1

:

3-(Bromomethyl)-5-methoxy-1H-indole

Description:
3-(Bromomethyl)-5-methoxy-1H-indole is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromomethyl group at the 3-position and a methoxy group at the 5-position contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic indole system and the methoxy substituent, which can influence its biological activity and solubility. The bromomethyl group can serve as a reactive site for further chemical modifications, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the indole framework is known for its occurrence in various natural products and pharmaceuticals, suggesting that derivatives of this compound may possess interesting pharmacological properties. As with many brominated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns associated with bromine-containing chemicals.
Formula:C10H10BrNO
InChI:InChI=1S/C10H10BrNO/c1-13-8-2-3-10-9(4-8)7(5-11)6-12-10/h2-4,6,12H,5H2,1H3
InChI key:InChIKey=GGKHKTAIXSMRIE-UHFFFAOYSA-N
SMILES:C(Br)C=1C=2C(NC1)=CC=C(OC)C2
Synonyms:
  • 1H-Indole, 3-(bromomethyl)-5-methoxy-
  • 3-(Bromomethyl)-5-methoxy-1H-indole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.