CAS 1261236-40-1
:3-(3-Methyl-5-isoxazolyl)benzenamine
Description:
3-(3-Methyl-5-isoxazolyl)benzenamine, identified by its CAS number 1261236-40-1, is an organic compound characterized by the presence of both an isoxazole ring and an aniline structure. The isoxazole moiety contributes to its potential biological activity, as this five-membered heterocyclic compound often exhibits various pharmacological properties. The methyl group at the 3-position of the isoxazole enhances its lipophilicity, potentially influencing its interaction with biological targets. The benzenamine part of the molecule indicates the presence of an amino group, which can participate in hydrogen bonding and may affect the compound's solubility and reactivity. Overall, this compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the context of targeting specific biological pathways or receptors. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods or referenced from chemical databases for practical applications.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-7-5-10(13-12-7)8-3-2-4-9(11)6-8/h2-6H,11H2,1H3
InChI key:InChIKey=BACHVIPKDQXWEC-UHFFFAOYSA-N
SMILES:NC=1C=C(C=CC1)C=2ON=C(C)C2
Synonyms:- Benzenamine, 3-(3-methyl-5-isoxazolyl)-
- 3-(3-Methyl-5-isoxazolyl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.