
CAS 1261236-48-9
:Methyl 7-methoxy-3-quinolinecarboxylate
Description:
Methyl 7-methoxy-3-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a methoxy group (-OCH3) at the 7-position and a carboxylate group at the 3-position, contributing to its reactivity and potential biological activity. It is typically a yellow to brown solid, soluble in organic solvents, and exhibits moderate stability under standard conditions. The presence of the methoxy group can influence its electronic properties and reactivity, making it of interest in medicinal chemistry and organic synthesis. Compounds of this nature may exhibit various biological activities, including antimicrobial or anticancer properties, although specific biological data would depend on empirical studies. Its synthesis often involves multi-step organic reactions, and it may serve as an intermediate in the production of more complex molecules. As with many organic compounds, safety precautions should be observed when handling this substance due to potential toxicity or reactivity.
Formula:C12H11NO3
InChI:InChI=1S/C12H11NO3/c1-15-10-4-3-8-5-9(12(14)16-2)7-13-11(8)6-10/h3-7H,1-2H3
InChI key:InChIKey=MWPAWFRYCVOTTE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC2=C(C=C(OC)C=C2)N=C1
Synonyms:- Methyl 7-methoxy-3-quinolinecarboxylate
- 3-Quinolinecarboxylic acid, 7-methoxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.