CymitQuimica logo

CAS 1261236-65-0

:

3-(2-Nitrophenyl)-4-isoxazolemethanol

Description:
3-(2-Nitrophenyl)-4-isoxazolemethanol is a chemical compound characterized by its unique structural features, which include an isoxazole ring and a nitrophenyl group. The presence of the isoxazole moiety contributes to its potential biological activity, as this heterocyclic structure is often found in various pharmaceuticals and agrochemicals. The nitrophenyl substituent can influence the compound's electronic properties, potentially enhancing its reactivity and interaction with biological targets. This compound may exhibit solubility in organic solvents, and its properties can be affected by the presence of functional groups, such as the hydroxymethyl group, which can participate in hydrogen bonding. The compound's molecular weight, melting point, and other physical properties would typically be determined through experimental methods. Additionally, its safety and handling would be guided by standard protocols for chemical substances, particularly those containing nitro groups, which can pose specific hazards. Overall, 3-(2-Nitrophenyl)-4-isoxazolemethanol represents a class of compounds with potential applications in medicinal chemistry and material science.
Formula:C10H8N2O4
InChI:InChI=1S/C10H8N2O4/c13-5-7-6-16-11-10(7)8-3-1-2-4-9(8)12(14)15/h1-4,6,13H,5H2
InChI key:InChIKey=PVKHJDVCESIUFA-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=CC=C1)C=2C(CO)=CON2
Synonyms:
  • 3-(2-Nitrophenyl)-4-isoxazolemethanol
  • 4-Isoxazolemethanol, 3-(2-nitrophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.