
CAS 1261268-98-7
:5-[4-Fluoro-3-(trifluoromethyl)phenyl]-2H-tetrazole
Description:
5-[4-Fluoro-3-(trifluoromethyl)phenyl]-2H-tetrazole is a chemical compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. This compound features a phenyl group substituted with a fluorine atom and a trifluoromethyl group, contributing to its unique properties. The presence of these fluorinated groups often enhances the compound's lipophilicity and stability, making it of interest in various applications, including pharmaceuticals and agrochemicals. The tetrazole moiety is known for its ability to form strong hydrogen bonds and can participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the compound may exhibit interesting biological activities, which can be explored in drug development. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the design of compounds with specific biological targets. As with many fluorinated compounds, it may also exhibit distinct physical and chemical properties, such as altered solubility and reactivity compared to non-fluorinated analogs.
Formula:C8H4F4N4
InChI:InChI=1S/C8H4F4N4/c9-6-2-1-4(7-13-15-16-14-7)3-5(6)8(10,11)12/h1-3H,(H,13,14,15,16)
InChI key:InChIKey=DJAVSIDVPRVJEA-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1F)C=2NN=NN2
Synonyms:- 2H-Tetrazole, 5-[4-fluoro-3-(trifluoromethyl)phenyl]-
- 5-[4-Fluoro-3-(trifluoromethyl)phenyl]-2H-tetrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
