CAS 1261268-99-8

N-[4-[6-[(Cyclopropylcarbonyl)amino]-1H-benzimidazol-2-yl]phenyl]benzamide

Description:

N-[4-[6-[(Cyclopropylcarbonyl)amino]-1H-benzimidazol-2-yl]phenyl]benzamide, with the CAS number 1261268-99-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzimidazole moiety and a cyclopropylcarbonyl group. This compound typically exhibits properties associated with its aromatic and heterocyclic components, such as potential solubility in organic solvents and moderate stability under standard laboratory conditions. The presence of multiple functional groups suggests that it may engage in various chemical interactions, including hydrogen bonding and π-π stacking, which could influence its biological activity. Compounds of this nature are often investigated for their pharmacological properties, particularly in the context of drug development, due to their ability to interact with biological targets. Additionally, the structural features may confer specific reactivity patterns, making it a candidate for further research in medicinal chemistry and related fields.

Formula: C₂₄H₂₀N₄O₂

InChI: InChI=1S/C24H20N4O2/c29-23(16-4-2-1-3-5-16)25-18-10-8-15(9-11-18)22-27-20-13-12-19(14-21(20)28-22)26-24(30)17-6-7-17/h1-5,8-14,17H,6-7H2,(H,25,29)(H,26,30)(H,27,28)

InChI key: InChIKey=LMROEKCUDPNHDU-UHFFFAOYSA-N

SMILES: N(C(=O)C1CC1)C=2C=C3C(NC(=N3)C4=CC=C(NC(=O)C5=CC=CC=C5)C=C4)=CC2

Synonyms:

• N-[4-[6-[(Cyclopropylcarbonyl)amino]-1H-benzimidazol-2-yl]phenyl]benzamide
• Benzamide, N-[4-[6-[(cyclopropylcarbonyl)amino]-1H-benzimidazol-2-yl]phenyl]-

Benzamide, N-[4-[6-[(cyclopropylcarbonyl)amino]-1H-benzimidazol-2-yl]phenyl]-

CAS: 1261268-99-8

Formula: C₂₄H₂₀N₄O₂

Purity: 95%

Molecular weight: 396.4412

Ref: IN-DA000RQ3