CAS 1261269-07-1
:Ethyl 4-(2-bromophenyl)-2-thiazolecarboxylate
Description:
Ethyl 4-(2-bromophenyl)-2-thiazolecarboxylate is an organic compound characterized by its thiazole and bromophenyl functional groups. It features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen, contributing to its reactivity and potential biological activity. The presence of the ethyl ester group enhances its solubility in organic solvents, making it suitable for various chemical reactions and applications. The bromophenyl substituent introduces a bromine atom, which can influence the compound's electronic properties and reactivity, potentially enhancing its interactions in biological systems. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its unique structure allows for potential applications in the development of agrochemicals or pharmaceuticals. As with many organic compounds, safety and handling precautions should be observed due to the presence of bromine and the potential for toxicity. Overall, Ethyl 4-(2-bromophenyl)-2-thiazolecarboxylate represents a versatile compound with significant implications in chemical research and development.
Formula:C12H10BrNO2S
InChI:InChI=1S/C12H10BrNO2S/c1-2-16-12(15)11-14-10(7-17-11)8-5-3-4-6-9(8)13/h3-7H,2H2,1H3
InChI key:InChIKey=SLXFMMOYYUZOAC-UHFFFAOYSA-N
SMILES:BrC1=C(C=2N=C(C(OCC)=O)SC2)C=CC=C1
Synonyms:- Ethyl 4-(2-bromophenyl)-2-thiazolecarboxylate
- 2-Thiazolecarboxylic acid, 4-(2-bromophenyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ethyl 4-(2-Bromophenyl)thiazole-2-carboxylate
CAS:<p>Ethyl 4-(2-Bromophenyl)thiazole-2-carboxylate</p>Molecular weight:312.18g/mol

