
CAS 1261269-76-4
:4-Amino-6-methoxy-2(1H)-quinolinone
Description:
4-Amino-6-methoxy-2(1H)-quinolinone is a chemical compound characterized by its quinoline structure, which features a methoxy group and an amino group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the amino and methoxy substituents. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as quinolinone derivatives are known for their diverse biological activities, including antimicrobial and antitumor properties. The presence of the amino group can enhance solubility and reactivity, while the methoxy group may influence the compound's electronic properties and steric hindrance. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 4-Amino-6-methoxy-2(1H)-quinolinone represents a significant structure in the realm of organic chemistry and drug development, warranting further investigation into its potential uses and mechanisms of action.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-14-6-2-3-9-7(4-6)8(11)5-10(13)12-9/h2-5H,1H3,(H3,11,12,13)
InChI key:InChIKey=IRECAFBJOCNICR-UHFFFAOYSA-N
SMILES:NC=1C=2C(NC(=O)C1)=CC=C(OC)C2
Synonyms:- 4-Amino-6-methoxy-2(1H)-quinolinone
- 2(1H)-Quinolinone, 4-amino-6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.