CAS 1261269-81-1

1-(Cyclopropylmethyl)cyclohexanecarboxylic acid

Description:

1-(Cyclopropylmethyl)cyclohexanecarboxylic acid is an organic compound characterized by its cyclohexane backbone with a cyclopropylmethyl group and a carboxylic acid functional group. This compound features a cyclohexane ring, which contributes to its stability and hydrophobic characteristics, while the cyclopropylmethyl substituent introduces unique steric and electronic properties that can influence its reactivity and interactions. The presence of the carboxylic acid group imparts acidic properties, allowing the compound to participate in acid-base reactions and potentially form salts or esters. The molecular structure suggests that it may exhibit moderate solubility in polar solvents due to the carboxylic acid functionality, while the bulky cyclohexane and cyclopropyl groups may hinder extensive hydrogen bonding. Additionally, the compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, given its unique structural features. Overall, its characteristics are defined by the interplay of its functional groups and the cyclic structures present in its molecular framework.

Formula: C₁₁H₁₈O₂

InChI: InChI=1S/C11H18O2/c12-10(13)11(8-9-4-5-9)6-2-1-3-7-11/h9H,1-8H2,(H,12,13)

InChI key: InChIKey=SOHYRWYYABDZMB-UHFFFAOYSA-N

SMILES: C(C1(C(O)=O)CCCCC1)C2CC2

Synonyms:

• Cyclohexanecarboxylic acid, 1-(cyclopropylmethyl)-
• 1-(Cyclopropylmethyl)cyclohexanecarboxylic acid