CAS 126127-31-9

N-[2-Hydroxy-1-(hydroxymethyl)ethyl]hexadecanamide

Description:

N-[2-Hydroxy-1-(hydroxymethyl)ethyl]hexadecanamide, also known by its CAS number 126127-31-9, is a synthetic compound characterized by its long-chain fatty acid amide structure. This substance features a hexadecanamide backbone, which contributes to its hydrophobic properties, while the presence of hydroxyl groups introduces hydrophilicity, enhancing its solubility in polar solvents. The compound is typically used in various applications, including as a surfactant, emulsifier, or stabilizer in formulations. Its unique structure allows it to interact with both hydrophilic and hydrophobic environments, making it valuable in cosmetic and pharmaceutical formulations. Additionally, the presence of hydroxymethyl and hydroxy groups may impart biological activity, potentially influencing cell membrane interactions or serving as a precursor in biochemical pathways. Overall, N-[2-Hydroxy-1-(hydroxymethyl)ethyl]hexadecanamide exhibits a balance of hydrophilic and hydrophobic characteristics, making it a versatile compound in chemical and industrial applications.

Formula: C₁₉H₃₉NO₃

InChI: InChI=1S/C19H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(23)20-18(16-21)17-22/h18,21-22H,2-17H2,1H3,(H,20,23)

InChI key: InChIKey=MZUNFYMZKTWADX-UHFFFAOYSA-N

SMILES: N(C(CO)CO)C(CCCCCCCCCCCCCCC)=O

Synonyms:

• Hexadecanamide, N-[2-hydroxy-1-(hydroxymethyl)ethyl]-
• N-[2-Hydroxy-1-(Hydroxymethyl)Ethyl]-Hexadecanamide
• Palmitoyl Serinol

N-Palmitoyl serinol

CAS: 126127-31-9

N-Palmitoyl serinol

Purity: 95%

Molecular weight: 329.52g/mol

Ref: 54-OR1043970

Palmitoyl serinol

CAS: 126127-31-9

Anticancer agent 110 is an anticancer compound with cytotoxic, antitumor and antileukemic activities.

Formula: C₁₉H₃₉NO₃

Color and Shape: Solid

Molecular weight: 329.52

Ref: TM-T60957

N-(1,3-Dihydroxypropan-2-yl)palmitamide

CAS: 126127-31-9

Formula: C₁₉H₃₉NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 329.5179

Ref: IN-DA000RQC