CAS 126128-42-5
:6-(BETA-D-2-DEOXYRIBOFURANOSYL)-3,4-DIHYDRO-8H-PYRIMIDO-[4,5-C][1,2]OXAZIN-7-ONE
Description:
6-(Beta-D-2-deoxyribofuranosyl)-3,4-dihydro-8H-pyrimido[4,5-c][1,2]oxazin-7-one is a nucleoside analog that exhibits structural features characteristic of both pyrimidine and oxazine derivatives. This compound is notable for its fused bicyclic structure, which contributes to its potential biological activity. The presence of the deoxyribofuranosyl moiety suggests that it may interact with nucleic acids, potentially influencing processes such as DNA replication or transcription. The compound's dihydro form indicates that it may exist in a reduced state, which can affect its reactivity and stability. Additionally, the oxazine ring may impart unique chemical properties, such as the ability to participate in hydrogen bonding or act as a weak base. This substance has garnered interest in medicinal chemistry, particularly for its potential antiviral or anticancer properties, although specific biological activities would depend on further empirical studies. Overall, its complex structure and potential interactions with biological macromolecules make it a subject of interest in pharmaceutical research.
Formula:C11H15N3O5
InChI:InChI=1/C11H15N3O5/c15-5-8-7(16)3-9(19-8)14-4-6-1-2-18-13-10(6)12-11(14)17/h4,7-9,15-16H,1-3,5H2,(H,12,13,17)/t7-,8+,9-/m0/s1
Synonyms:- 6-(2-Deoxy-beta-D-erythro-pentofuranosyl)-4,6-dihydro-1H-pyrimido(4,5-c)(1,2)oxazin-7(3H)-one
- 6-(2-deoxy-alpha-D-erythro-pentofuranosyl)-4,6-dihydro-1H-pyrimido[4,5-c][1,2]oxazin-7(3H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
P-2'-deoxyribose
CAS:P-2'-deoxyribose (P-Nucleoside) is a deoxyribose that is widely found in organisms.Formula:C11H15N3O5Purity:99.71%Color and Shape:SolidMolecular weight:269.25Ref: TM-TNU1281
1mg109.00€2mg160.00€5mg261.00€10mg374.00€25mg583.00€50mg803.00€100mg1,063.00€200mg1,431.00€6-(β-D-2-Deoxyribofuranosyl)-3,4-dihydro-8H-pyrimido[4,5-c][1,2]oxazin-7-one
CAS:6-(β-D-2-Deoxyribofuranosyl)-3,4-dihydro-8H-pyrimido[4,5-c][1,2]oxazin-7-one is a novel nucleoside that has been shown to have anticancer and antiviral properties. In vitro studies have shown the compound to activate both DNA and RNA synthesis in cells. The compound also inhibits the replication of HIV viruses. 6-(β-D-2-Deoxyribofuranosyl)-3,4-dihydro-8H-pyrimido[4,5-c][1,2]oxazin-7-one is synthesized from ribonucleosides or deoxyribonucleosides through phosphoramidite chemistry. This product is available in high purity and high quality.Formula:C11H15N3O5Purity:Min. 95%Color and Shape:PowderMolecular weight:269.25 g/mol


