CAS 126132-93-2

N-1,3-Benzodioxol-5-ylglycine methyl ester

Description:

N-1,3-Benzodioxol-5-ylglycine methyl ester, with the CAS number 126132-93-2, is a chemical compound characterized by its unique structure that includes a benzodioxole moiety and a glycine derivative. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It is often studied for its role in medicinal chemistry, particularly in the context of neuropharmacology and as a potential therapeutic agent. The presence of the methyl ester group suggests that it may have enhanced lipophilicity, which can influence its absorption and distribution in biological systems. Additionally, the benzodioxole structure is known for its ability to interact with various biological targets, making this compound of interest in drug development. Its solubility, stability, and reactivity can vary based on environmental conditions, and it may undergo hydrolysis to release the corresponding glycine derivative. Overall, N-1,3-Benzodioxol-5-ylglycine methyl ester represents a class of compounds that bridge organic chemistry and pharmacology.

Formula: C₁₀H₁₁NO₄

InChI: InChI=1S/C10H11NO4/c1-13-10(12)5-11-7-2-3-8-9(4-7)15-6-14-8/h2-4,11H,5-6H2,1H3

InChI key: InChIKey=OBXAWNJYVSCLBR-UHFFFAOYSA-N

SMILES: N(CC(OC)=O)C=1C=C2C(=CC1)OCO2

Synonyms:

• Glycine, N-1,3-benzodioxol-5-yl-, methyl ester
• N-1,3-Benzodioxol-5-ylglycine methyl ester