CAS 1261365-32-5
:6-Bromo-5-hydroxy-4-iodo-2-pyridinemethanol
Description:
6-Bromo-5-hydroxy-4-iodo-2-pyridinemethanol is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with bromine, iodine, and hydroxyl functional groups. The presence of these halogens and the hydroxyl group suggests that the compound may exhibit unique reactivity and solubility properties, potentially making it useful in various chemical applications, including medicinal chemistry and organic synthesis. The bromine and iodine substituents can influence the compound's electronic properties, potentially enhancing its biological activity or reactivity in chemical reactions. Additionally, the hydroxyl group may contribute to hydrogen bonding capabilities, affecting its solubility in polar solvents. As with many halogenated compounds, considerations regarding stability, toxicity, and environmental impact are essential for handling and application. Overall, 6-Bromo-5-hydroxy-4-iodo-2-pyridinemethanol represents a compound of interest for further research, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C6H5BrINO2
InChI:InChI=1S/C6H5BrINO2/c7-6-5(11)4(8)1-3(2-10)9-6/h1,10-11H,2H2
InChI key:InChIKey=IMXKWIJLBNXVQS-UHFFFAOYSA-N
SMILES:C(O)C1=CC(I)=C(O)C(Br)=N1
Synonyms:- 2-Bromo-6-(hydroxymethyl)-4-iodopyridin-3-ol
- 2-Pyridinemethanol, 6-bromo-5-hydroxy-4-iodo-
- 6-Bromo-5-hydroxy-4-iodo-2-pyridinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.