CAS 1261365-35-8
:3-Methoxy-1,5-naphthyridine
Description:
3-Methoxy-1,5-naphthyridine is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. The presence of a methoxy group (-OCH3) at the 3-position contributes to its chemical reactivity and solubility properties. This compound typically exhibits a pale to light yellow appearance and is soluble in organic solvents. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry and drug development. The nitrogen atoms in the naphthyridine ring can participate in hydrogen bonding and coordination with metal ions, which may influence its biological activity. Additionally, 3-Methoxy-1,5-naphthyridine may exhibit fluorescence properties, making it useful in various analytical applications. Its synthesis often involves multi-step organic reactions, and it can serve as a precursor for further chemical modifications. Overall, this compound's unique structural features and functional groups make it a valuable subject of study in both organic chemistry and pharmacology.
Formula:C9H8N2O
InChI:InChI=1S/C9H8N2O/c1-12-7-5-9-8(11-6-7)3-2-4-10-9/h2-6H,1H3
InChI key:InChIKey=GPQLUYHSHWAIPB-UHFFFAOYSA-N
SMILES:O(C)C1=CC2=C(N=C1)C=CC=N2
Synonyms:- 1,5-Naphthyridine, 3-methoxy-
- 3-Methoxy-1,5-naphthyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
