CAS 1261365-41-6
:2,3-Dihydro-7-[2-(trimethylsilyl)ethynyl]-1,4-dioxino[2,3-b]pyridine
Description:
2,3-Dihydro-7-[2-(trimethylsilyl)ethynyl]-1,4-dioxino[2,3-b]pyridine is a complex organic compound characterized by its unique structural features, which include a dioxin ring fused to a pyridine moiety. The presence of the trimethylsilyl group attached to an ethynyl substituent enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. This compound exhibits potential biological activity, which may be attributed to its heterocyclic structure, often associated with pharmacological properties. The dioxin and pyridine components contribute to its reactivity, allowing for further functionalization. Additionally, the compound's molecular geometry and electronic properties can influence its interactions with biological targets or catalysts. As with many organic compounds, safety and handling precautions are essential, given the potential for toxicity or reactivity under certain conditions. Overall, 2,3-Dihydro-7-[2-(trimethylsilyl)ethynyl]-1,4-dioxino[2,3-b]pyridine represents a versatile structure in organic chemistry with implications in medicinal chemistry and materials science.
Formula:C12H15NO2Si
InChI:InChI=1S/C12H15NO2Si/c1-16(2,3)7-4-10-8-11-12(13-9-10)15-6-5-14-11/h8-9H,5-6H2,1-3H3
InChI key:InChIKey=BTHBOCUKDGDVNA-UHFFFAOYSA-N
SMILES:C(#C[Si](C)(C)C)C=1C=C2C(=NC1)OCCO2
Synonyms:- 2,3-Dihydro-7-[2-(trimethylsilyl)ethynyl]-1,4-dioxino[2,3-b]pyridine
- 1,4-Dioxino[2,3-b]pyridine, 2,3-dihydro-7-[2-(trimethylsilyl)ethynyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.