CAS 1261365-43-8

1-(2,3-Dihydro-6-iodo-7-methyl-1H-pyrido[2,3-b][1,4]oxazin-1-yl)-2,2-dimethyl-1-propanone

Description:

1-(2,3-Dihydro-6-iodo-7-methyl-1H-pyrido[2,3-b][1,4]oxazin-1-yl)-2,2-dimethyl-1-propanone, with CAS number 1261365-43-8, is a synthetic organic compound characterized by its complex structure, which includes a pyrido[2,3-b][1,4]oxazine moiety. This compound features a 2,3-dihydro form, indicating the presence of a saturated ring system, and incorporates an iodine atom, which can influence its reactivity and biological activity. The presence of the ketone functional group (propanone) suggests potential for reactivity in nucleophilic addition reactions. Its unique structural features may confer specific pharmacological properties, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular architecture. As with many organic compounds, its behavior in biological systems, including potential therapeutic applications or toxicity, would require further investigation through experimental studies. Overall, this compound exemplifies the complexity and diversity found in organic chemistry, particularly in the realm of heterocyclic compounds.

Formula: C₁₃H₁₇IN₂O₂

InChI: InChI=1S/C13H17IN2O2/c1-8-7-9-11(15-10(8)14)18-6-5-16(9)12(17)13(2,3)4/h7H,5-6H2,1-4H3

InChI key: InChIKey=LLWFXBGMCOOQRH-UHFFFAOYSA-N

SMILES: C(C(C)(C)C)(=O)N1C=2C(=NC(I)=C(C)C2)OCC1

Synonyms:

• 1-Propanone, 1-(2,3-dihydro-6-iodo-7-methyl-1H-pyrido[2,3-b][1,4]oxazin-1-yl)-2,2-dimethyl-
• 1-(2,3-Dihydro-6-iodo-7-methyl-1H-pyrido[2,3-b][1,4]oxazin-1-yl)-2,2-dimethyl-1-propanone