CAS 1261365-48-3

5-Bromo-2-(2-hydroxyethoxy)-3-pyridinol

Description:

5-Bromo-2-(2-hydroxyethoxy)-3-pyridinol is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with a hydroxyethoxy group and at the 5-position with a bromine atom. This compound features a hydroxyl group that enhances its solubility in polar solvents and may contribute to its biological activity. The presence of the bromine atom can influence the compound's reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The molecular structure suggests that it may exhibit properties such as antimicrobial or antifungal activity, although specific biological effects would depend on further empirical studies. Additionally, the compound's functional groups indicate potential for hydrogen bonding, which could affect its interactions in biological systems. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of bromine, which can be hazardous. Overall, 5-Bromo-2-(2-hydroxyethoxy)-3-pyridinol represents a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₇H₈BrNO₃

InChI: InChI=1S/C7H8BrNO3/c8-5-3-6(11)7(9-4-5)12-2-1-10/h3-4,10-11H,1-2H2

InChI key: InChIKey=QHIMHBCUJNRUDJ-UHFFFAOYSA-N

SMILES: O(CCO)C1=C(O)C=C(Br)C=N1

Synonyms:

• 5-Bromo-2-(2-hydroxyethoxy)-3-pyridinol
• 3-Pyridinol, 5-bromo-2-(2-hydroxyethoxy)-