CAS 1261365-49-4
:1,1-Dimethylethyl N-[4-methoxy-3-(2-propen-1-yl)-2-pyridinyl]carbamate
Description:
1,1-Dimethylethyl N-[4-methoxy-3-(2-propen-1-yl)-2-pyridinyl]carbamate, identified by its CAS number 1261365-49-4, is a chemical compound that belongs to the class of carbamates. This substance features a pyridine ring substituted with a methoxy group and an allyl group, contributing to its unique reactivity and potential biological activity. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and agrochemical applications. Its structural characteristics suggest potential uses in the development of pharmaceuticals or as a pesticide, although specific applications would depend on further research into its efficacy and safety profiles. As with many chemical substances, proper handling and safety measures should be observed due to potential toxicity or environmental impact.
Formula:C14H20N2O3
InChI:InChI=1S/C14H20N2O3/c1-6-7-10-11(18-5)8-9-15-12(10)16-13(17)19-14(2,3)4/h6,8-9H,1,7H2,2-5H3,(H,15,16,17)
InChI key:InChIKey=KZGLXTDLGBAJLV-UHFFFAOYSA-N
SMILES:C(C=C)C1=C(NC(OC(C)(C)C)=O)N=CC=C1OC
Synonyms:- 1,1-Dimethylethyl N-[4-methoxy-3-(2-propen-1-yl)-2-pyridinyl]carbamate
- Carbamic acid, N-[4-methoxy-3-(2-propen-1-yl)-2-pyridinyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
