CAS 1261365-52-9

3,6-Dichloro-5-hydroxy-4-iodo-2-pyridinemethanol

Description:

3,6-Dichloro-5-hydroxy-4-iodo-2-pyridinemethanol is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with multiple halogen atoms and a hydroxymethyl group. The presence of chlorine and iodine atoms contributes to its reactivity and potential biological activity, making it of interest in various fields, including medicinal chemistry. The hydroxyl group enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound's unique combination of functional groups suggests potential applications in pharmaceuticals, particularly as a precursor or intermediate in the synthesis of more complex molecules. Additionally, the specific arrangement of substituents on the pyridine ring can affect its electronic properties, influencing its behavior in chemical reactions and interactions with other substances. As with many halogenated compounds, considerations regarding environmental impact and toxicity are essential in its handling and application.

Formula: C₆H₄Cl₂INO₂

InChI: InChI=1S/C6H4Cl2INO2/c7-3-2(1-11)10-6(8)5(12)4(3)9/h11-12H,1H2

InChI key: InChIKey=FUULUSWRAABWGU-UHFFFAOYSA-N

SMILES: C(O)C1=C(Cl)C(I)=C(O)C(Cl)=N1

Synonyms:

• 3,6-Dichloro-5-hydroxy-4-iodo-2-pyridinemethanol
• 2-Pyridinemethanol, 3,6-dichloro-5-hydroxy-4-iodo-