CAS 1261365-54-1
:1,5-Naphthyridine-3-methanol
Description:
1,5-Naphthyridine-3-methanol is a heterocyclic organic compound characterized by a naphthyridine ring system, which consists of a fused bicyclic structure containing nitrogen atoms. This compound features a hydroxymethyl group (-CH2OH) at the 3-position of the naphthyridine ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the hydroxymethyl group enhances its solubility in polar solvents and may influence its biological activity. 1,5-Naphthyridine derivatives are often studied for their pharmacological properties, including antimicrobial and anticancer activities. The compound's molecular structure allows for various functionalizations, making it a versatile intermediate in organic synthesis. Additionally, its nitrogen-containing ring system can participate in coordination chemistry, potentially forming complexes with metal ions. Overall, 1,5-Naphthyridine-3-methanol is of interest in both academic research and industrial applications due to its unique structural features and potential biological significance.
Formula:C9H8N2O
InChI:InChI=1S/C9H8N2O/c12-6-7-4-9-8(11-5-7)2-1-3-10-9/h1-5,12H,6H2
InChI key:InChIKey=FONKMHAKOWUIOL-UHFFFAOYSA-N
SMILES:C(O)C1=CC2=C(N=C1)C=CC=N2
Synonyms:- 1,5-Naphthyridin-3-ylmethanol
- 1,5-Naphthyridine-3-methanol
- (1,5-Naphthyridin-3-yl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.