CymitQuimica logo

CAS 1261365-55-2

:

4-Iodo-1,5-naphthyridin-3-amine

Description:
4-Iodo-1,5-naphthyridin-3-amine is a chemical compound characterized by its unique structure, which includes a naphthyridine core substituted with an iodine atom and an amino group. This compound typically exhibits properties associated with heterocyclic aromatic compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of the amino group, which can participate in various chemical reactions, including nucleophilic substitutions. The iodine substituent can influence the compound's electronic properties and reactivity, making it a candidate for various applications in medicinal chemistry and material science. Additionally, the presence of the naphthyridine moiety may impart biological activity, as many derivatives of naphthyridine are known for their pharmacological properties. The compound's molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Overall, 4-Iodo-1,5-naphthyridin-3-amine represents a versatile scaffold for further chemical modifications and investigations in various fields of research.
Formula:C8H6IN3
InChI:InChI=1S/C8H6IN3/c9-7-5(10)4-12-6-2-1-3-11-8(6)7/h1-4H,10H2
InChI key:InChIKey=JVBCOKNQHUKGGS-UHFFFAOYSA-N
SMILES:IC=1C2=C(N=CC1N)C=CC=N2
Synonyms:
  • 4-Iodo-1,5-naphthyridin-3-amine
  • 1,5-Naphthyridin-3-amine, 4-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.