CAS 1261365-56-3
:5-Bromo-2-iodo-1H-pyrrolo[2,3-b]pyridine
Description:
5-Bromo-2-iodo-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and iodine substituents enhances its reactivity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound typically exhibits moderate to high solubility in organic solvents, reflecting its polar nature due to the halogen substituents. Its molecular structure allows for potential participation in various chemical reactions, such as nucleophilic substitutions and cross-coupling reactions. Additionally, the compound may exhibit interesting biological activities, which can be explored in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Overall, 5-Bromo-2-iodo-1H-pyrrolo[2,3-b]pyridine is a significant compound in synthetic organic chemistry with potential applications in various fields.
Formula:C7H4BrIN2
InChI:InChI=1S/C7H4BrIN2/c8-5-1-4-2-6(9)11-7(4)10-3-5/h1-3H,(H,10,11)
InChI key:InChIKey=XLGARLVBAUBSRZ-UHFFFAOYSA-N
SMILES:IC=1NC=2C(C1)=CC(Br)=CN2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-2-iodo-
- 5-Bromo-2-iodo-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.